For research use only. Not for therapeutic Use.
Iron chelator Dp44mT (Cat.No:M127094) is a potent metal-binding compound known for its ability to selectively target and remove excess iron from cells. Its high affinity for iron makes it a potential therapeutic agent for iron-overload disorders and certain cancers, where iron plays a crucial role in disease progression.
| Catalog Number | M127094 |
| CAS Number | 152095-12-0 |
| Synonyms | (Z)-N/’-(di(pyridin-2-yl)methylene)-N,N-dimethylcarbamohydrazonothioic acid |
| Molecular Formula | C14H15N5S |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea |
| InChI | InChI=1S/C14H15N5S/c1-19(2)14(20)18-17-13(11-7-3-5-9-15-11)12-8-4-6-10-16-12/h3-10H,1-2H3,(H,18,20) |
| InChIKey | XOBIGRNRXCAMJQ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)NN=C(C1=CC=CC=N1)C2=CC=CC=N2 |
