For research use only. Not for therapeutic Use.
Iron(II) nitrate(Cat No.:M062291), or ferrous nitrate, is a chemical compound. It is formed by the reaction of iron and nitric acid. This compound appears as a pale violet or light green crystal when hydrated and is highly soluble in water. Iron(II) nitrate is used primarily as a mordant in dyeing processes and laboratories for various chemical synthesis and reactions. It serves as an oxidizing agent and a source of ferrous ions, crucial in coordination chemistry for synthesizing coordination complexes.
CAS Number | 14013-86-6 |
Molecular Formula | FeN2O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | iron(2+);dinitrate |
InChI | InChI=1S/Fe.2NO3/c;2*2-1(3)4/q+2;2*-1 |
InChIKey | MVFCKEFYUDZOCX-UHFFFAOYSA-N |
SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Fe+2] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |