For research use only. Not for therapeutic Use.
Irsogladine（Cat No.:I005053） is a compound that acts as a phosphodiesterase 4 (PDE4) inhibitor and a muscarinic acetylcholine receptor binder. As a PDE4 inhibitor, it blocks the activity of the enzyme phosphodiesterase 4, which is involved in the breakdown of cyclic adenosine monophosphate (cAMP). By inhibiting PDE4, irsogladine increases cAMP levels, leading to various physiological effects. Additionally, it binds to muscarinic acetylcholine receptors, which are involved in neurotransmission and play a role in various physiological processes. The exact mechanisms and therapeutic applications of irsogladine are still being investigated.
| Catalog Number | I005053 |
| CAS Number | 84504-69-8 |
| Molecular Formula | C13H11Cl2N5O4 |
| Purity | ≥95% |
| Target | PDE4; mACHR |
| Solubility | DMSO:25 mg/ml; 100 mM in ethanol ; |
| Storage | Room Temperature |
| IUPAC Name | (Z)-but-2-enedioic acid;6-(2,5-dichlorophenyl)-1,3,5-triazine-2,4-diamine |
| InChI | InChI=1S/C9H7Cl2N5.C4H4O4/c10-4-1-2-6(11)5(3-4)7-14-8(12)16-9(13)15-7;5-3(6)1-2-4(7)8/h1-3H,(H4,12,13,14,15,16);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | PJLVTVAIERNDEQ-BTJKTKAUSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=NC(=NC(=N2)N)N)Cl.C(=CC(=O)O)C(=O)O |
| Reference | <p style=/line-height:25px/> <br>[1]. Ren, C.J., et al., Irsogladine maleate inhibits angiogenesis in wild-type and plasminogen activator-deficient mice. J Surg Res, 1998. 77(2): p. 126-31. <br>[2]. Kawasaki, Y., et al., Irsogladine malate up-regulates gap junctional intercellular communication between pancreatic cancer cells via PKA pathway. Pancreas, 2002. 25(4): p. 373-7. <br>[3]. Kyoi, T., et al., Phosphodiesterase inhibition by a gastroprotective agent irsogladine: preferential blockade of cAMP hydrolysis. Life Sci, 2004. 75(15): p. 1833-42. |
