For research use only. Not for therapeutic Use.
Isepamicin（Cat No.:I029531）is a high-purity aminoglycoside antibiotic widely used in microbiological and pharmaceutical research. It exhibits broad-spectrum activity against Gram-negative and some Gram-positive bacteria by inhibiting bacterial protein synthesis through binding to the 30S ribosomal subunit. Known for its resistance to aminoglycoside-modifying enzymes, Isepamicin is effective against resistant bacterial strains, including those producing β-lactamases. Its stability and efficacy make it a valuable tool for studying antimicrobial mechanisms, drug resistance, and therapeutic strategies. Isepamicin supports advancements in infection control and the development of novel antibacterial therapies.
| Catalog Number | I029531 |
| CAS Number | 58152-03-7 |
| Synonyms | HAPA-B; HAPA-gentamycin B; Isepamicin; Isepamicina; SCH21420; SCH 21420; SCH-21420 |
| Molecular Formula | C22H42N5O11 |
| Purity | 98% |
| Target | Antibiotic |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (2S)-3-amino-N-[(1R,2S,3S,4R,5S)-5-amino-4-[(2R,3R,4S,5S,6R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-2-[(2R,3R,4R,5R)-3,5-dihydroxy-5-methyl-4-(methylamino)oxan-2-yl]oxy-3-hydroxycyclohexyl]-2-hydroxypropanamide |
| InChI | InChI=1S/C22H43N5O12/c1-22(35)6-36-20(15(33)18(22)26-2)39-17-8(27-19(34)9(28)4-23)3-7(25)16(14(17)32)38-21-13(31)12(30)11(29)10(5-24)37-21/h7-18,20-21,26,28-33,35H,3-6,23-25H2,1-2H3,(H,27,34)/t7-,8+,9-,10+,11+,12-,13+,14-,15+,16+,17-,18+,20+,21+,22-/m0/s1 |
| InChIKey | UDIIBEDMEYAVNG-ZKFPOVNWSA-N |
| SMILES | C[C@@]1(CO[C@@H]([C@@H]([C@H]1NC)O)O[C@H]2[C@@H](C[C@@H]([C@H]([C@@H]2O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CN)O)O)O)N)NC(=O)[C@H](CN)O)O |
| Reference | 1. Barr WH, Colucci R, Radwanski E, Zampaglione N, Cutler D, Lin CC, Elliott M, Affrime MB. Pharmacokinetics of isepamicin. J Chemother. 1995 Jun;7 Suppl 2:53-61. PMID: 8622111. |
