For research use only. Not for therapeutic Use.
Iso-Pentylbenzene is an organic compound consisting of a benzene ring attached to an iso-pentyl group. It is commonly used as a starting material or intermediate in the synthesis of various chemicals, including fragrances, polymers, and specialty chemicals. Its branched alkyl chain enhances its solubility and reactivity in organic reactions. Iso-pentylbenzene is particularly useful in organic synthesis and industrial applications, where it contributes to the development of bioactive molecules, polymers, and other advanced materials in chemical manufacturing.
| Catalog Number | M050270 |
| CAS Number | 1595-04-6 |
| Molecular Formula | C11H16 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-butyl-3-methylbenzene |
| InChI | InChI=1S/C11H16/c1-3-4-7-11-8-5-6-10(2)9-11/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | OAPCPUDMDJIBOQ-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=CC(=C1)C |
