For research use only. Not for therapeutic Use.
Isoamyl nitrite-15N(Cat No.:M027232) is a chemical variant of isoamyl nitrite where the nitrogen atom in the nitrite group is replaced with nitrogen-15, a stable isotope of nitrogen. This modification is commonly used in scientific research to trace and study the behavior and dynamics of nitrite in various chemical and biological processes. Isoamyl nitrite itself is an organic compound used medically for the treatment of heart diseases like angina pectoris, functioning as a vasodilator to quickly relax and dilate blood vessels, thereby improving blood flow and reducing heart strain.
CAS Number | 120670-20-4 |
Molecular Formula | C5H11NO2 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 3-methylbutyl nitrite |
InChI | InChI=1S/C5H11NO2/c1-5(2)3-4-8-6-7/h5H,3-4H2,1-2H3/i6+1 |
InChIKey | OWFXIOWLTKNBAP-PTQBSOBMSA-N |
SMILES | CC(C)CCO[15N]=O |