For research use only. Not for therapeutic Use.
Isobutyl 2-(methylamino)benzoate(Cat No.:M006296)is an organic compound used in pharmaceutical research and organic synthesis. The molecule features a benzoate ester linked to an isobutyl group and a methylamino group at the 2-position on the benzene ring. This structure provides unique reactivity, making it a valuable intermediate in the synthesis of complex molecules, including potential drug candidates. The ester and amine functionalities allow for diverse chemical modifications, making it essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced synthetic materials.
CAS Number | 65505-24-0 |
Synonyms | isobutyl 2-(methylamino)benzoate;Benzoic acid, 2-(methylamino)-, 2-methylpropyl ester;ISOBUTYLN-METHYLANTHRANILATE;Isobutyl-2-(methylamino)benzoat;2-(methylamino)-benzoic acid 2-methylpropyl ester;N-Methylanthranilic acid isobutyl ester |
Molecular Formula | C12H17NO2 |
Purity | ≥95% |
IUPAC Name | 2-methylpropyl 2-(methylamino)benzoate |
InChI | InChI=1S/C12H17NO2/c1-9(2)8-15-12(14)10-6-4-5-7-11(10)13-3/h4-7,9,13H,8H2,1-3H3 |
InChIKey | WKYZGTHZBSYUFI-UHFFFAOYSA-N |
SMILES | CC(C)COC(=O)C1=CC=CC=C1NC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |