For research use only. Not for therapeutic Use.
Isobutyl acrylate (Cat.No:M068880) is a versatile chemical compound used in the production of coatings, adhesives, and sealants. Its reactive double bond allows it to undergo polymerization, resulting in materials with desirable properties like flexibility and adhesion. Isobutyl acrylate finds wide application in industries like paints, textiles, and adhesives.
CAS Number | 106-63-8 |
Molecular Formula | C7H12O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-methylpropyl prop-2-enoate |
InChI | InChI=1S/C7H12O2/c1-4-7(8)9-5-6(2)3/h4,6H,1,5H2,2-3H3 |
InChIKey | CFVWNXQPGQOHRJ-UHFFFAOYSA-N |
SMILES | CC(C)COC(=O)C=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |