For research use only. Not for therapeutic Use.
Isobutylamido thiazolyl resorcinol(CAT: L000380) is a compound with substantial applications in the pharmaceutical and organic chemistry domains. This chemical is valuable in the development of pharmaceutical agents, particularly in the field of dermatology. It is used for its potential as a melanin synthesis inhibitor, making it a key component in the formulation of skin-lightening or anti-pigmentation products.
CAS Number | 1428450-95-6 |
Molecular Formula | C13H14N2O3S |
Purity | 97% |
Documentation | |
IUPAC Name | N-[4-(2,4-dihydroxyphenyl)-1,3-thiazol-2-yl]-2-methylpropanamide |
InChI | InChI=1S/C13H14N2O3S/c1-7(2)12(18)15-13-14-10(6-19-13)9-4-3-8(16)5-11(9)17/h3-7,16-17H,1-2H3,(H,14,15,18) |
InChIKey | WIDNAJNXDPHROL-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |