For research use only. Not for therapeutic Use.
Isobutyrylshikonin is a naturally occurring naphthoquinone derivative extracted from the roots of Lithospermum erythrorhizon, commonly used in traditional medicine and pharmaceutical research. It possesses various bioactive properties, including anti-inflammatory, anticancer, and antimicrobial effects. Isobutyrylshikonin inhibits tumor growth by inducing apoptosis and inhibiting angiogenesis, making it a valuable compound in cancer research. Its anti-inflammatory activity also supports its use in skin care formulations and wound healing. This compound continues to be studied for its potential therapeutic applications in modern medicine.
| Catalog Number | R072557 |
| CAS Number | 52438-12-7 |
| Molecular Formula | C20H22O6 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| IUPAC Name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2-methylpropanoate |
| InChI | InChI=1S/C20H22O6/c1-10(2)5-8-16(26-20(25)11(3)4)12-9-15(23)17-13(21)6-7-14(22)18(17)19(12)24/h5-7,9,11,16,21-22H,8H2,1-4H3/t16-/m1/s1 |
| InChIKey | BVRYLTBIGIAADD-MRXNPFEDSA-N |
| SMILES | CC(C)C(=O)OC(CC=C(C)C)C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O |
