For research use only. Not for therapeutic Use.
Isocalamendiol is a sesquiterpenoid compound commonly isolated from plants, particularly from species in the Asteraceae family. It is known for its bioactive properties, including anti-inflammatory, antimicrobial, and antioxidant effects. Due to these properties, Isocalamendiol is being investigated for its potential therapeutic applications, particularly in the treatment of inflammation-related conditions and infections. Its complex structure and biological activity make it a subject of interest in pharmacological and natural product research, where it is studied for its role in modulating immune responses and as a lead compound for drug discovery efforts.
CAS Number | 25330-21-6 |
Molecular Formula | C15H26O2 |
Purity | ≥95% |
Storage | 3 years -20C powder |
IUPAC Name | (1R,4S,4aR,8aS)-1-methyl-6-methylidene-4-propan-2-yl-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1,4a-diol |
InChI | InChI=1S/C15H26O2/c1-10(2)12-7-8-14(4,16)13-6-5-11(3)9-15(12,13)17/h10,12-13,16-17H,3,5-9H2,1-2,4H3/t12-,13-,14+,15+/m0/s1 |
InChIKey | AHNGXHRYFGQWSL-BYNSBNAKSA-N |
SMILES | CC(C)C1CCC(C2C1(CC(=C)CC2)O)(C)O |