For research use only. Not for therapeutic Use.
Isocanadine(CAT: I029549) is an isomer of canadine. Canadine, also known as tetrahydroberberine and xanthopuccine, is a type of benzylisoquinoline alkaloid (BIA). It belongs to the protoberberine structural subgroup and is found in various plants from the Papaveraceae family, including Corydalis yanhusuo and C. turtschaninovii. These plants have been used in traditional medicine for their potential therapeutic properties. Canadine and its isomer, isocanadine, are of interest in scientific research due to their natural occurrence and potential pharmacological activities.
| Catalog Number | I029549 |
| CAS Number | 6656-19-5 |
| Synonyms | (±)-Isocanadine; Tetrahydropseudoberberine; DC037021; |
| Molecular Formula | C20H21NO4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 5,8,13,13a-Tetrahydro-10,11-dimethoxy-6H-benzo[g]-1,3-benzodioxolo[5,6-a]quinolizine |
| InChI | InChI=1S/C20H21NO4/c1-22-17-7-13-5-16-15-9-20-19(24-11-25-20)6-12(15)3-4-21(16)10-14(13)8-18(17)23-2/h6-9,16H,3-5,10-11H2,1-2H3 |
| InChIKey | HCRLQVVXDCKIFD-UHFFFAOYSA-N |
| SMILES | COC1=C(OC)C=C2CN3CCC4=C(C=C5OCOC5=C4)C3CC2=C1 |
| Reference | Xie X, Lu X, Liu Y, Xu W. Palladium(II)-catalyzed synthesis of alpha-alkylidene-gamma-butyrolactams from N-allylic 2-alkynamides. Total synthesis of (+/-)-isocynodine and (+/-)-isocynometrine. J Org Chem. 2001;66(20):6545‐6550. doi:10.1021/jo001704u |
