For research use only. Not for therapeutic Use.
Isocaryophyllene is a naturally occurring sesquiterpene found in various essential oils, used in pharmaceutical and biochemical research. It is known for its potential anti-inflammatory, analgesic, and antimicrobial properties. This compound is essential for studying the pharmacological activities of natural products and developing therapeutic agents, ensuring precise and reliable results in advanced medicinal chemistry and natural product research.
| Catalog Number | R014776 |
| CAS Number | 118-65-0 |
| Synonyms | (Z)-(1R,9S)-(-)-4,11,11-Trimethyl-8-methylene-bicyclo[7.2.0]undec-4-ene; [1R-(1R*,4Z,9S*)]-4,11,11-Trimethyl-8-methylene-bicyclo[7.2.0]undec-4-ene; Isocaryophyllene; (-)-Isocaryophyllene; (Z)-Caryophyllene; (-)-Isocaryophyllene; cis-Caryophyllene; γ |
| Molecular Formula | C15H24 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (1R,4Z,9S)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene |
| InChI | InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6-/t13-,14-/m1/s1 |
| InChIKey | NPNUFJAVOOONJE-FLFDDASRSA-N |
| SMILES | CC1=CCCC(=C)C2CC(C2CC1)(C)C |
