For research use only. Not for therapeutic Use.
Isochenodeoxycholic acid (Cat No.:C000800) is a bile acid derivative with a modified cholic acid structure. It exhibits distinct properties compared to its parent compound chenodeoxycholic acid, which plays a role in fat digestion and cholesterol metabolism. Isochenodeoxycholic acid may impact hepatic and intestinal functions, potentially affecting bile acid signaling pathways. Researchers likely investigate its physiological effects, potential therapeutic applications, and influence on lipid metabolism. By studying its interactions with receptors and enzymes, insights into its role in digestion, absorption, and cholesterol homeostasis could lead to advancements in gastrointestinal health and the development of targeted interventions for related disorders.
| Catalog Number | C000800 |
| CAS Number | 566-24-5 |
| Synonyms | (3β,5β,7α)-3,7-Dihydroxycholan-24-oic Acid; 3β,7α-Dihydroxy-5β-cholan-24-oic Acid; 3β,7α-Dihydroxy-5β-cholanic Acid; 3β,7α-Dihydroxy-5β-cholanoic Acid; 3β-Chenodeoxycholic Acid; BAR601; Isochenodeoxycholic Acid; |
| Molecular Formula | C₂₄H₄₀O₄ |
| Purity | ≥95% |
| Solubility | Acetonitrile (Slightly, Heated), Methanol (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C |
| IUPAC Name | (4R)-4-[(3S,5S,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| InChI | InChI=1S/C24H40O4/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16+,17-,18+,19+,20-,22+,23+,24-/m1/s1 |
| InChIKey | RUDATBOHQWOJDD-JGFDLHJZSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)O)C)O)C |
| Reference | Danzinger, et al.: N. Engl. J. Med., 286, 1 (1972), Iser, J.H., et al.: Drugs, 21, 90 (1981), Tint, G.S., et al.: Gastroenterology, 91, 1007 (1986), |
