For research use only. Not for therapeutic Use.
Isocryptolepine(CAT: I029553) is a natural indoloquinoline alkaloid derived from plants in the Cryptolepis genus, widely studied for its pharmacological properties. It exhibits antimalarial, anticancer, and antimicrobial activities, making it a valuable compound in drug discovery and medicinal chemistry. Isocryptolepine works by intercalating into DNA, inhibiting topoisomerase activity, and disrupting cellular replication processes. Additionally, it has shown potential in modulating inflammatory pathways and oxidative stress. Researchers use Isocryptolepine to explore novel therapeutic strategies for infectious diseases, cancer, and inflammation-related conditions, providing insights into its mechanisms of action and potential clinical applications.
Synonyms | Isocryptolepine; |
Molecular Formula | C16H12N2 |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 5-methyl-5H-indolo[3,2-c]quinoline |
InChI | InChI=1S/C16H12N2/c1-18-10-13-11-6-2-4-8-14(11)17-16(13)12-7-3-5-9-15(12)18/h2-10H,1H3 |
InChIKey | GLYLOCYYFNTVGX-UHFFFAOYSA-N |
SMILES | CN1C2=CC=CC=C2C3=NC4=CC=CC=C4C3=C1 |