For research use only. Not for therapeutic Use.
Isoformononetin-d3(Cat No.:I041337)is a deuterated form of isoformononetin, a naturally occurring isoflavonoid compound found in plants such as red clover and soybeans. The “d3” indicates that three hydrogen atoms have been replaced by deuterium, a stable isotope of hydrogen. This modification is often used in mass spectrometry to trace the compound’s metabolism and study its pharmacokinetics in biological systems. Isoformononetin is known for its potential health benefits, including antioxidant, anti-inflammatory, and estrogenic effects. Isoformononetin-d3 is valuable for research in drug development, metabolic studies, and the investigation of isoflavonoid activity.
Synonyms | 3-(4-hydroxyphenyl)-7-(trideuteriomethoxy)chromen-4-one |
Molecular Formula | C16H9D3O4 |
Purity | ≥95% |
IUPAC Name | 3-(4-hydroxyphenyl)-7-(trideuteriomethoxy)chromen-4-one |
InChI | InChI=1S/C16H12O4/c1-19-12-6-7-13-15(8-12)20-9-14(16(13)18)10-2-4-11(17)5-3-10/h2-9,17H,1H3/i1D3 |
InChIKey | LNIQZRIHAMVRJA-FIBGUPNXSA-N |
SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)C(=O)C(=CO2)C3=CC=C(C=C3)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |