For research use only. Not for therapeutic Use.
Forsythiaside(Cat No.:M073414)is a natural compound with notable antiviral and antioxidative effects. It exhibits inhibitory properties against pathogenic bacteria, including Staphylococcus aureus. Additionally, it can inhibit phosphodiesterase, fungi, and reactive oxygen species. Forsythiaside holds potential as a natural drug, natural preservative, and natural antioxidant, offering broad application prospects. Its diverse range of activities makes it a valuable compound for further research and development in various fields, including medicine, food preservation, and antioxidant supplementation.
CAS Number | 1357910-26-9 |
Synonyms | Isoforsythiaside |
Molecular Formula | C29H36O15 |
Purity | ≥95% |
Target | Bacterial |
Storage | Store at -20°C |
IUPAC Name | [(2R,3R,4S,5R,6R)-2-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-4-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
InChI | InChI=1S/C29H36O15/c1-13-22(35)24(37)25(38)28(42-13)41-12-20-23(36)27(44-21(34)7-4-14-2-5-16(30)18(32)10-14)26(39)29(43-20)40-9-8-15-3-6-17(31)19(33)11-15/h2-7,10-11,13,20,22-33,35-39H,8-9,12H2,1H3/b7-4+/t13-,20+,22-,23+,24+,25+,26+,27-,28+,29+/m0/s1 |
InChIKey | GKRBWXABVALDGQ-GCELSKRESA-N |
SMILES | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OCCC3=CC(=C(C=C3)O)O)O)OC(=O)C=CC4=CC(=C(C=C4)O)O)O)O)O)O |