For research use only. Not for therapeutic Use.
Isogarcinol(CAT: R066913) is a naturally occurring polyisoprenylated benzophenone found in the fruit rind and other parts of Garcinia species, particularly Garcinia cambogia and Garcinia mangostana. This compound has attracted significant interest due to its diverse biological activities, including antioxidant, anti-inflammatory, antiviral, and anticancer properties. Isogarcinol has been studied for its ability to inhibit key enzymes, such as histone acetyltransferases, which play a role in the regulation of gene expression. Additionally, it has shown potential in modulating immune responses and inducing apoptosis in cancer cells, making it a promising candidate for drug development. The compound is also explored for its neuroprotective effects and its role in the prevention of neurodegenerative diseases. Due to its potent bioactivity, Isogarcinol is of particular interest in natural product research and the development of therapeutic agents.
CAS Number | 71117-97-0 |
Synonyms | Cambogin |
Molecular Formula | C38H50O6 |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | (1S,3S,9R,11R)-7-(3,4-dihydroxybenzoyl)-4,4,10,10-tetramethyl-3,9,11-tris(3-methylbut-2-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione |
InChI | InChI=1S/C38H50O6/c1-22(2)11-14-26-20-37-21-27(15-12-23(3)4)36(9,10)44-33(37)30(31(41)25-13-16-28(39)29(40)19-25)32(42)38(34(37)43,35(26,7)8)18-17-24(5)6/h11-13,16-17,19,26-27,39-40H,14-15,18,20-21H2,1-10H3/t26-,27+,37+,38+/m1/s1 |
InChIKey | KXTNVBQRLRYVCO-LPSZMIQCSA-N |
SMILES | CC(=CCC1CC23CC(C(OC2=C(C(=O)C(C3=O)(C1(C)C)CC=C(C)C)C(=O)C4=CC(=C(C=C4)O)O)(C)C)CC=C(C)C)C |