For research use only. Not for therapeutic Use.
Isohexanol-d7（Cat No.:R046457） is a deuterated form of isohexanol, featuring seven deuterium atoms. This high-purity compound is crucial in advanced pharmaceutical and biochemical research, particularly in studying alcohols and their metabolic pathways. Its stable isotope labeling ensures precise and accurate mass spectrometric analysis, facilitating investigations into pharmacokinetics, environmental studies, and chemical synthesis. With consistent and reliable performance, Isohexanol-d7 is ideal for rigorous experimental setups, offering a robust and cost-effective solution for high-precision scientific research and the development of novel therapeutic agents and industrial applications.
| Catalog Number | R046457 |
| CAS Number | 1246819-30-6 |
| Synonyms | 4-Methyl-1-pentanol-d7; Anglamol 6085U-d7; NSC 91492-d7; iso-Hexanol-d7; |
| Molecular Formula | C6H14O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentan-1-ol |
| InChI | InChI=1S/C6H14O/c1-6(2)4-3-5-7/h6-7H,3-5H2,1-2H3/i1D3,2D3,6D |
| InChIKey | PCWGTDULNUVNBN-NWOXSKRJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(CCCO)C([2H])([2H])[2H] |
