For research use only. Not for therapeutic Use.
Isohexanol is a branched-chain alcohol with a six-carbon structure and a hydroxyl group, commonly used as a solvent and intermediate in organic synthesis. Its branched nature imparts distinct physical and chemical properties, such as moderate volatility and solubility, making it valuable in the formulation of coatings, adhesives, and plasticizers. Isohexanol also finds applications in the production of esters and in fragrance chemistry, where its structural versatility allows it to enhance the synthesis of specialized compounds in industrial and pharmaceutical fields.
| Catalog Number | R046458 |
| CAS Number | 626-89-1 |
| Synonyms | 4-Methyl-1-pentanol; Anglamol 6085U; NSC 91492; iso-Hexanol; |
| Molecular Formula | C6H14O |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | -20°C |
| IUPAC Name | 4-methylpentan-1-ol |
| InChI | InChI=1S/C6H14O/c1-6(2)4-3-5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | PCWGTDULNUVNBN-UHFFFAOYSA-N |
| SMILES | CC(C)CCCO |
