For research use only. Not for therapeutic Use.
Isolariciresinol is a lignan found in various plants, used in pharmaceutical and biochemical research. Known for its antioxidant, anti-inflammatory, and potential anticancer properties, it is essential for studying the biological activities and therapeutic potential of natural compounds. This compound aids in understanding the mechanisms of action and health benefits of lignans. Researchers rely on Isolariciresinol for precise and reliable results in advanced natural product chemistry, drug discovery, and medicinal research, contributing significantly to innovations in health and wellness.
| Catalog Number | R011434 |
| CAS Number | 548-29-8 |
| Molecular Formula | C20H24O6 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | Store at -20°C |
| IUPAC Name | (6R,7R,8S)-8-(4-hydroxy-3-methoxyphenyl)-6,7-bis(hydroxymethyl)-3-methoxy-5,6,7,8-tetrahydronaphthalen-2-ol |
| InChI | InChI=1S/C20H24O6/c1-25-18-6-11(3-4-16(18)23)20-14-8-17(24)19(26-2)7-12(14)5-13(9-21)15(20)10-22/h3-4,6-8,13,15,20-24H,5,9-10H2,1-2H3/t13-,15-,20-/m0/s1 |
| InChIKey | OGFXBIXJCWAUCH-KPHUOKFYSA-N |
| SMILES | COC1=C(C=C2C(C(C(CC2=C1)CO)CO)C3=CC(=C(C=C3)O)OC)O |
