For research use only. Not for therapeutic Use.
Isolicoflavonol is a naturally occurring flavonoid found in various plants, known for its potential health benefits. It exhibits antioxidant, anti-inflammatory, and anticancer properties, making it a subject of interest in pharmaceutical and nutritional research. Isolicoflavonol is particularly noted for its role in promoting cardiovascular health and supporting metabolic processes. Its presence in dietary sources highlights its significance in traditional medicine and contemporary health applications. Ongoing studies continue to explore its mechanisms of action and therapeutic potential in various health conditions.
| Catalog Number | R055173 |
| CAS Number | 94805-83-1 |
| Synonyms | 3,5,7-trihydroxy-2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]chromen-4-one |
| Molecular Formula | C20H18O6 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H18O6/c1-10(2)3-4-11-7-12(5-6-14(11)22)20-19(25)18(24)17-15(23)8-13(21)9-16(17)26-20/h3,5-9,21-23,25H,4H2,1-2H3 |
| InChIKey | PGCKDCPTJAQQSQ-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)C |
