For research use only. Not for therapeutic Use.
Isoliensinine(CAT: R072564) is a natural alkaloid compound found in certain plant sources, particularly in species of the Nelumbo genus, such as Nelumbo nucifera (lotus). Its mode of action involves being an alkaloid with various pharmacological properties. Isoliensinine has been studied for its potential cardiovascular effects, including vasodilation and antiarrhythmic actions. Additionally, it exhibits anti-inflammatory and analgesic properties. This compound is of interest in traditional medicine and herbal remedies, and further research is ongoing to explore its specific mechanisms and potential therapeutic applications.
CAS Number | 6817-41-0 |
Molecular Formula | C37H42N2O6 |
Purity | ≥95% |
Target | Apoptosis |
IUPAC Name | (1R)-1-[[4-hydroxy-3-[[(1R)-6-methoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]phenyl]methyl]-6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-ol |
InChI | InChI=1S/C37H42N2O6/c1-38-15-13-26-20-36(44-5)37(22-29(26)30(38)16-23-6-9-27(42-3)10-7-23)45-35-18-24(8-11-32(35)40)17-31-28-21-33(41)34(43-4)19-25(28)12-14-39(31)2/h6-11,18-22,30-31,40-41H,12-17H2,1-5H3/t30-,31-/m1/s1 |
InChIKey | AJPXZTKPPINUKN-FIRIVFDPSA-N |
SMILES | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)OC)OC4=C(C=CC(=C4)CC5C6=CC(=C(C=C6CCN5C)OC)O)O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |