For research use only. Not for therapeutic Use.
Isoliquiritigenin(Cat No.:I005698)is a natural chalcone flavonoid derived from licorice root (Glycyrrhiza uralensis), widely studied for its antioxidant, anti-inflammatory, and anticancer properties. It works by inhibiting various signaling pathways, including NF-κB and MAPK, which are involved in inflammation and tumor growth. Isoliquiritigenin has shown potential in reducing oxidative stress, protecting liver function, and inducing apoptosis in cancer cells, making it a candidate for therapeutic development. Additionally, its estrogenic effects offer potential benefits in managing menopausal symptoms, highlighting its versatility in pharmacological and nutraceutical research.
CAS Number | 961-29-5 |
Synonyms | GU-17 |
Molecular Formula | C15H12O4 |
Purity | ≥95% |
Target | Anti-infection |
Solubility | DMSO 20 mg/ml; Water <0.1 mg/ml |
Storage | 3 years -20C powder |
IC50 | 320 nM |
IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
InChI | InChI=1S/C15H12O4/c16-11-4-1-10(2-5-11)3-8-14(18)13-7-6-12(17)9-15(13)19/h1-9,16-17,19H/b8-3+ |
InChIKey | DXDRHHKMWQZJHT-FPYGCLRLSA-N |
SMILES | C1=CC(=CC=C1/C=C/C(=O)C2=C(C=C(C=C2)O)O)O |
Reference | <p> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |