For research use only. Not for therapeutic Use.
Isoliquiritin(Cat No.:R066133)is an isomer of liquidity, appearing as a yellow crystal that is soluble in various organic solvents such as methanol, ethanol, n-propanol, and isopropanol. It has been found to possess multiple beneficial properties through modern research. Isoliquiritin exhibits antioxidant effects, has the potential for treating ulcers, depressive psychosis, and AIDS, and can serve as an adjunctive treatment for diabetes. These findings highlight the diverse therapeutic potential of isoliquiritin, but further research is required to fully understand its mechanisms and optimize its clinical applications.
CAS Number | 5041-81-6 |
Molecular Formula | C21H22O9 |
Purity | ≥95% |
Target | Fungal |
Storage | -20°C |
IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one |
InChI | InChI=1S/C21H22O9/c22-10-17-18(26)19(27)20(28)21(30-17)29-13-5-1-11(2-6-13)3-8-15(24)14-7-4-12(23)9-16(14)25/h1-9,17-23,25-28H,10H2/b8-3+/t17-,18-,19+,20-,21-/m1/s1 |
InChIKey | YNWXJFQOCHMPCK-LXGDFETPSA-N |
SMILES | C1=CC(=CC=C1/C=C/C(=O)C2=C(C=C(C=C2)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |