For research use only. Not for therapeutic Use.
Isolongifolene (Cat No.:M047095) is a tricyclic sesquiterpene extracted from Murraya koenigii. It demonstrates a range of beneficial effects, including attenuating rotenone-induced oxidative stress, mitochondrial dysfunction, and apoptosis through the modulation of the P13K/AKT/GSK-3β signaling pathway. This compound showcases antioxidant, anti-inflammatory, anticancer, and neuroprotective properties. Due to its diverse and promising properties, isolongifolene holds potential for further exploration in various medical fields, including cancer therapy, neuroprotection, and the development of therapeutic agents for oxidative stress-related conditions.
CAS Number | 1135-66-6 |
Molecular Formula | C15H24 |
Purity | ≥95% |
Target | Apoptosis |
Storage | 2-8°C |
IUPAC Name | (1R,8S)-2,2,7,7-tetramethyltricyclo[6.2.1.01,6]undec-5-ene |
InChI | InChI=1S/C15H24/c1-13(2)8-5-6-12-14(3,4)11-7-9-15(12,13)10-11/h6,11H,5,7-10H2,1-4H3/t11-,15-/m0/s1 |
InChIKey | CQUAYTJDLQBXCQ-NHYWBVRUSA-N |
SMILES | CC1(CCC=C2C13CCC(C3)C2(C)C)C |