For research use only. Not for therapeutic Use.
Isomaltotriose (Cat No.: I017303) is mainly composed of oligosaccharides such as isomaltose, pantose and isomaltotriose. Isomaltooligosaccharide has the general characteristics of low viscosity, heat resistance, acid resistance, moisture retention, starch aging prevention, low water activity, bacteria purification, and difficult fermentation. It is mainly used as feed biological additives.
| Catalog Number | I017303 |
| CAS Number | 3371-50-4 |
| Molecular Formula | C₁₈H₃₂O₁₆ |
| Purity | ≥95% |
| Storage | room temp |
| IUPAC Name | (3R,4S,5S,6R)-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
| InChI | InChI=1S/C18H32O16/c19-1-4-7(20)11(24)14(27)17(33-4)31-3-6-9(22)12(25)15(28)18(34-6)30-2-5-8(21)10(23)13(26)16(29)32-5/h4-29H,1-3H2/t4-,5-,6-,7-,8-,9-,10+,11+,12+,13-,14-,15-,16?,17+,18+/m1/s1 |
| InChIKey | FBJQEBRMDXPWNX-FYHZSNTMSA-N |
| SMILES | C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OCC3C(C(C(C(O3)O)O)O)O)O)O)O)O)O)O)O |
| Reference | [1]. ALLENE JEANES, et al. Isomaltose and Isomaltotriose from Enzymic Hydrolyzates of Dextran. |
