For research use only. Not for therapeutic Use.
(+)-Isomenthone（Cat No.:R024733）is a naturally occurring monoterpene found in the essential oils of various mint species, including peppermint and spearmint. It is valued for its minty aroma and cooling properties, making it a popular ingredient in the fragrance, flavor, and cosmetic industries. In addition to its sensory attributes, (+)-Isomenthone has shown potential therapeutic benefits, such as antimicrobial, anti-inflammatory, and analgesic effects. High-purity (+)-Isomenthone is essential for research and product formulation, ensuring consistency and reliability in applications ranging from personal care products to medicinal studies.
| Catalog Number | R024733 |
| CAS Number | 1196-31-2 |
| Synonyms | (2R,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one |
| Molecular Formula | C10H18O |
| Purity | ≥95% |
| IUPAC Name | (2R,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one |
| InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | NFLGAXVYCFJBMK-RKDXNWHRSA-N |
| SMILES | CC1CCC(C(=O)C1)C(C)C |
