For research use only. Not for therapeutic Use.
Isometronidazole is a nitroimidazole derivative known for its antimicrobial properties, particularly against anaerobic bacteria and protozoa. This compound is commonly used in veterinary medicine and human healthcare to treat infections such as amoebiasis and bacterial vaginosis. Isometronidazole works by disrupting DNA synthesis in target organisms, leading to cell death. Its effectiveness and safety profile make it a valuable therapeutic agent. Researchers continue to investigate its mechanisms of action and potential applications in treating various infectious diseases, enhancing its clinical utility.
CAS Number | 705-19-1 |
Synonyms | 2-Methyl-4-nitro-1H-imidazole-1-ethanol; 1-(2-Hydroxyethyl)-2-methyl-4-nitroimidazole; Izoklion; Mizonidazole; RP 8979; SC-16427 |
Molecular Formula | C6H9N3O3 |
Purity | ≥95% |
Storage | Store at -80 ℃ |
IUPAC Name | 2-(2-methyl-4-nitroimidazol-1-yl)ethanol |
InChI | InChI=1S/C6H9N3O3/c1-5-7-6(9(11)12)4-8(5)2-3-10/h4,10H,2-3H2,1H3 |
InChIKey | RSXWJXPKLRYMHW-UHFFFAOYSA-N |
SMILES | CC1=NC(=CN1CCO)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |