For research use only. Not for therapeutic Use.
Isoniazid（Cat No.:A000339）is a first-line antibiotic used to treat and prevent tuberculosis (TB). It works by inhibiting the synthesis of mycolic acids, essential components of the bacterial cell wall in Mycobacterium tuberculosis. This bactericidal action effectively kills actively dividing TB bacteria. Isoniazid is often used in combination with other TB medications to prevent resistance. It is typically well-tolerated but can cause side effects such as liver toxicity and peripheral neuropathy, which are managed with regular monitoring and supplementation of vitamin B6. Its critical role in TB therapy makes Isoniazid indispensable in public health efforts to control TB.
| Catalog Number | A000339 |
| CAS Number | 54-85-3 |
| Synonyms | Isonicotinic acid hydrazide; Isonicotinohydrazide; 54-85-3; Pyridine-4-carbohydrazide; Rimifon |
| Molecular Formula | C6H7N3O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | pyridine-4-carbohydrazide |
| InChI | InChI=1S/C6H7N3O/c7-9-6(10)5-1-3-8-4-2-5/h1-4H,7H2,(H,9,10) |
| InChIKey | QRXWMOHMRWLFEY-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C(=O)NN |
