For research use only. Not for therapeutic Use.
Isopentyl formate, also known as isoamyl formate, is an ester formed from isopentyl alcohol and formic acid. This clear, colorless liquid has a characteristic fruity aroma reminiscent of ripe bananas or pear. It is commonly used in the food and fragrance industries as a flavoring agent and scent additive. Additionally, isopentyl formate serves as a solvent in various chemical reactions and applications. Its pleasant fragrance and volatility make it a popular choice in cosmetic formulations as well.
CAS Number | 110-45-2 |
Molecular Formula | C6H12O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-methylbutyl formate |
InChI | InChI=1S/C6H12O2/c1-6(2)3-4-8-5-7/h5-6H,3-4H2,1-2H3 |
InChIKey | XKYICAQFSCFURC-UHFFFAOYSA-N |
SMILES | CC(C)CCOC=O |