For research use only. Not for therapeutic Use.
Isopimpinellin（Cat No.:R006729）, is a naturally occurring compound found in various plant sources. It belongs to the class of coumarins and is characterized by a benzene ring fused to a lactone ring. Isopimpinellin has been studied for its potential antioxidant, anti-inflammatory, antimicrobial, and anticancer properties. It is naturally present in plants such as carrots, parsnips, and celery. Isopimpinellin exhibits phototoxicity and has been investigated for its potential medicinal applications in dermatology and as an anti-inflammatory agent, although further research is still needed.
| Catalog Number | R006729 |
| CAS Number | 482-27-9 |
| Synonyms | 4,9-Dimethoxy-furo[3,2-g]chromen-7-one; 4,9-Dimethoxy-7H-furo[3,2-g][1]benzopyran-7-one; |
| Molecular Formula | C13H10O5 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | 4,9-dimethoxyfuro[3,2-g]chromen-7-one |
| InChI | InChI=1S/C13H10O5/c1-15-10-7-3-4-9(14)18-12(7)13(16-2)11-8(10)5-6-17-11/h3-6H,1-2H3 |
| InChIKey | DFMAXQKDIGCMTL-UHFFFAOYSA-N |
| SMILES | COC1=C2C=COC2=C(C3=C1C=CC(=O)O3)OC |
