For research use only. Not for therapeutic Use.
Isoprene is a high-purity hydrocarbon used in polymer chemistry and industrial applications. This five-carbon diene is essential for producing synthetic rubber, particularly polyisoprene, and studying polymerization processes. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced material science and chemical synthesis. Ideal for experimental setups, isoprene enhances research accuracy and efficiency in various scientific investigations.
CAS Number | 78-79-5 |
Synonyms | 2-Methyl-1,3-butadiene; 2-Methylbutadiene; 3-Methyl-1,3-butadiene; Isopentadiene; NSC 9237; |
Molecular Formula | C5H8 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-methylbuta-1,3-diene |
InChI | InChI=1S/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3 |
InChIKey | RRHGJUQNOFWUDK-UHFFFAOYSA-N |
SMILES | CC(=C)C=C |