Home
>
Reference Standards>Bioactive Chemicals>Impurities> Isopropyl 5-(Diphenylphosphoryl)pentanoate
For research use only. Not for therapeutic Use.
Isopropyl 5-(Diphenylphosphoryl)pentanoate(CAT: R021695) is an organic compound characterized by its phosphorylated pentanoate ester structure, featuring a diphenylphosphoryl group. This compound is utilized in synthetic organic chemistry as a versatile building block for the development of more complex molecules. It is particularly valuable in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals, where the phosphoryl group can introduce unique reactivity and functionality. The isopropyl ester moiety enhances its solubility and stability, making it suitable for various chemical transformations and research applications.
Catalog Number | R021695 |
CAS Number | 2088449-88-9 |
Synonyms | Isopropyl 5-(Diphenylphosphinyl)pentanoic Acid; |
Molecular Formula | C₂₀H₂₅O₃P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | propan-2-yl 5-diphenylphosphorylpentanoate |
InChI | InChI=1S/C20H25O3P/c1-17(2)23-20(21)15-9-10-16-24(22,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-8,11-14,17H,9-10,15-16H2,1-2H3 |
InChIKey | NUSCAFULQNHZJJ-UHFFFAOYSA-N |
SMILES | CC(C)OC(=O)CCCCP(=O)(C1=CC=CC=C1)C2=CC=CC=C2 |