For research use only. Not for therapeutic Use.
Isopropylbiphenyl (Cat.No:I029590) is an organic compound commonly used as a heat transfer fluid and lubricant in various industrial applications. It has a high boiling point and good thermal stability, making it suitable for use in high-temperature processes. Isopropylbiphenyl is also used as a starting material in the synthesis of other chemicals.
| Catalog Number | I029590 |
| CAS Number | 25640-78-2 |
| Synonyms | Isopropylbiphenyl |
| Molecular Formula | C15H16 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | Isopropylbiphenyl |
| InChI | InChI=1S/C15H16/c1-12(2)14-10-6-7-11-15(14)13-8-4-3-5-9-13/h3-12H,1-2H3 |
| InChIKey | HKTCLPBBJDIBGF-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1C2=CC=CC=C2)C |
