For research use only. Not for therapeutic Use.
Isopropylidenemalononitrile（Cat No.:M054898）is a reactive organic compound widely used in chemical synthesis and pharmaceutical research. Featuring a highly strained isopropylidene group attached to a malononitrile core, this compound is valuable in the development of heterocyclic compounds and other complex molecules. Its unique structure makes it an essential intermediate in the preparation of various bioactive substances, including pharmaceuticals and agrochemicals. Isopropylidenemalononitrile is particularly useful in research involving synthetic pathways for novel compounds, enabling the exploration of new chemical reactions and mechanisms.
| Catalog Number | M054898 |
| CAS Number | 13166-10-4 |
| Molecular Formula | C6H6N2 |
| Purity | ≥95% |
| IUPAC Name | 2-propan-2-ylidenepropanedinitrile |
| InChI | InChI=1S/C6H6N2/c1-5(2)6(3-7)4-8/h1-2H3 |
| InChIKey | NVBHWAQBDJEGEO-UHFFFAOYSA-N |
| SMILES | CC(=C(C#N)C#N)C |
