For research use only. Not for therapeutic Use.
Isopsoralenoside（Cat No.:I010341）is a natural compound primarily derived from traditional medicinal plants and is recognized for its potential therapeutic properties. With its unique furanocoumarin structure, Isopsoralenoside plays a significant role in modulating various biological activities, including anti-inflammatory and antioxidant effects. This compound has been studied for its benefits in managing skin disorders and supporting liver health. Additionally, it is a valuable component in pharmacological research aimed at developing treatments for conditions related to oxidative stress and inflammation. Its purity and stability make it an essential tool for targeted research applications.
| Catalog Number | I010341 |
| CAS Number | 905954-18-9 |
| Molecular Formula | C₁₇H₁₈O₉ |
| Purity | ≥95% |
| Target | Bacterial |
| IUPAC Name | (Z)-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-benzofuran-5-yl]prop-2-enoic acid |
| InChI | InChI=1S/C17H18O9/c18-7-11-13(21)14(22)15(23)17(25-11)26-16-8(2-4-12(19)20)1-3-10-9(16)5-6-24-10/h1-6,11,13-15,17-18,21-23H,7H2,(H,19,20)/b4-2-/t11-,13-,14+,15-,17+/m1/s1 |
| InChIKey | CAMYXILYLXYDFE-MIVOEOINSA-N |
| SMILES | C1=CC2=C(C=CO2)C(=C1/C=C\C(=O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
| Reference | [1]. Yue-Fei Wang, et al.A UPLC-MS/MS method for in vivo and in vitro pharmacokinetic studies of psoralenoside, isopsoralenoside, psoralen and isopsoralen from Psoralea corylifolia extract. J Ethnopharmacol |
