For research use only. Not for therapeutic Use.
Isoquinoline-3-carboxylic acid is a heterocyclic aromatic compound featuring a carboxyl group at the 3rd position of the isoquinoline ring. It serves as a key building block in organic synthesis, particularly for pharmaceuticals and agrochemicals. Its structure allows for the development of bioactive molecules, including enzyme inhibitors and receptor modulators. Isoquinoline-3-carboxylic acid is also utilized in medicinal chemistry research for creating drug candidates that target various biological pathways, making it valuable in drug discovery and development.
Catalog Number | R034521 |
CAS Number | 6624-49-3 |
Synonyms | 3-Carboxyisoquinoline; 3-Isoquinaldic Acid; NSC 53385 |
Molecular Formula | C10H7NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | isoquinoline-3-carboxylic acid |
InChI | InChI=1S/C10H7NO2/c12-10(13)9-5-7-3-1-2-4-8(7)6-11-9/h1-6H,(H,12,13) |
InChIKey | KVMMIDQDXZOPAB-UHFFFAOYSA-N |
SMILES | C1=CC=C2C=NC(=CC2=C1)C(=O)O |