For research use only. Not for therapeutic Use.
Isoquinoline-8-carboxylic acid(Cat No.:L029177)is a key intermediate in organic synthesis, frequently used in pharmaceutical and chemical research. This compound, characterized by an isoquinoline ring with a carboxylic acid group at the 8-position, plays a crucial role in the development of various therapeutic agents and complex organic molecules. Its unique structure allows for diverse chemical transformations, making it a valuable tool in medicinal chemistry. Isoquinoline-8-carboxylic acid is essential for high-precision synthesis, contributing to the advancement of drug discovery and innovative chemical research.
CAS Number | 61563-43-7 |
Molecular Formula | C10H7NO2 |
Purity | ≥95% |
IUPAC Name | isoquinoline-8-carboxylic acid |
InChI | InChI=1S/C10H7NO2/c12-10(13)8-3-1-2-7-4-5-11-6-9(7)8/h1-6H,(H,12,13) |
InChIKey | VMNZQPRIUSJCOH-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=NC=C2)C(=C1)C(=O)O |