For research use only. Not for therapeutic Use.
Isorhamnetin 3-O-glucoside (Cat.No:R055398) is a flavonoid compound commonly found in various fruits and vegetables. It exhibits antioxidant and anti-inflammatory properties, contributing to potential health benefits. Isorhamnetin 3-O-glucoside is of interest in research exploring natural compounds for their therapeutic applications in various health conditions.
Catalog Number | R055398 |
CAS Number | 5041-82-7 |
Molecular Formula | C22H22O12 |
Purity | ≥95% |
Target | Disease Research Fields |
Storage | -20°C |
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
InChI | InChI=1S/C22H22O12/c1-31-12-4-8(2-3-10(12)25)20-21(17(28)15-11(26)5-9(24)6-13(15)32-20)34-22-19(30)18(29)16(27)14(7-23)33-22/h2-6,14,16,18-19,22-27,29-30H,7H2,1H3/t14-,16-,18+,19-,22+/m1/s1 |
InChIKey | CQLRUIIRRZYHHS-LFXZADKFSA-N |
SMILES | COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O)O |