For research use only. Not for therapeutic Use.
Isorhamnetin 3-robinobioside is a flavonoid glycoside found in various plants, known for its potent antioxidant, anti-inflammatory, and cardioprotective properties. As a derivative of isorhamnetin, it contributes to the scavenging of free radicals and the reduction of oxidative stress. This compound has been studied for its potential in preventing cardiovascular diseases, supporting vascular health, and reducing inflammation. Its natural occurrence in medicinal plants makes it a valuable candidate for developing supplements and functional foods aimed at promoting overall health.
CAS Number | 53584-69-3 |
Molecular Formula | C28H32O16 |
Purity | ≥95% |
Target | Plants |
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
InChI | InChI=1S/C28H32O16/c1-9-18(32)21(35)23(37)27(41-9)40-8-16-19(33)22(36)24(38)28(43-16)44-26-20(34)17-13(31)6-11(29)7-15(17)42-25(26)10-3-4-12(30)14(5-10)39-2/h3-7,9,16,18-19,21-24,27-33,35-38H,8H2,1-2H3/t9-,16+,18-,19-,21+,22-,23+,24+,27+,28?/m0/s1 |
InChIKey | UIDGLYUNOUKLBM-IDQQZYJHSA-N |
SMILES | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)OC)O)O)O)O)O)O |