For research use only. Not for therapeutic Use.
Isorhapontigenin (Cat No.:R061169) is a natural stilbene compound found in certain plants, such as Vitis vinifera (grape) and Rhaponticum carthamoides. It exhibits a range of biological activities, including anti-inflammatory, antioxidant, and anticancer properties. Research has shown that isorhapontigenin may help in protecting against oxidative stress and inflammation, making it a potential therapeutic agent for diseases like cardiovascular disorders and neurodegenerative diseases. It is also being studied for its ability to modulate cell growth and inhibit tumor formation.
| Catalog Number | R061169 |
| CAS Number | 32507-66-7 |
| Molecular Formula | C15H14O4 |
| Purity | ≥95% |
| Target | Autophagy |
| Storage | -20°C |
| IUPAC Name | 5-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]benzene-1,3-diol |
| InChI | InChI=1S/C15H14O4/c1-19-15-8-10(4-5-14(15)18)2-3-11-6-12(16)9-13(17)7-11/h2-9,16-18H,1H3/b3-2+ |
| InChIKey | ANNNBEZJTNCXHY-NSCUHMNNSA-N |
| SMILES | COC1=C(C=CC(=C1)C=CC2=CC(=CC(=C2)O)O)O |
