For research use only. Not for therapeutic Use.
Isorhynchophylline(Cat No.:I000056)is an alkaloid derived from the Uncaria species, known for its neuroprotective and cardiovascular benefits. It exhibits anti-inflammatory, antioxidant, and vasodilatory properties, making it a valuable compound in the treatment of hypertension and neurodegenerative diseases. Isorhynchophylline enhances cognitive function and protects against neuronal damage, showing potential in Alzheimer’s and Parkinson’s disease research. Additionally, it has been studied for its immune-modulating effects, contributing to its versatility in therapeutic applications. This natural compound is gaining attention for its potential to support brain health and cardiovascular wellness.
CAS Number | 6859-01-4 |
Molecular Formula | C22H28N2O4 |
Purity | ≥95% |
Target | SOD |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IUPAC Name | methyl (E)-2-[(3S,6'R,7'S,8'aS)-6'-ethyl-2-oxospiro[1H-indole-3,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate |
InChI | InChI=1S/C22H28N2O4/c1-4-14-12-24-10-9-22(17-7-5-6-8-18(17)23-21(22)26)19(24)11-15(14)16(13-27-2)20(25)28-3/h5-8,13-15,19H,4,9-12H2,1-3H3,(H,23,26)/b16-13+/t14-,15-,19-,22-/m0/s1 |
InChIKey | DAXYUDFNWXHGBE-VKCGGMIFSA-N |
SMILES | CCC1CN2CCC3(C2CC1C(=COC)C(=O)OC)C4=CC=CC=C4NC3=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |