For research use only. Not for therapeutic Use.
Isosakuranin is a natural product derived from the fruits of Paliurus ramosissimus[1].
| Catalog Number | I018445 |
| CAS Number | 491-69-0 |
| Synonyms | (2S)-5-hydroxy-2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| Molecular Formula | C22H24O10 |
| Purity | ≥95% |
| InChI | InChI=1S/C22H24O10/c1-29-11-4-2-10(3-5-11)15-8-14(25)18-13(24)6-12(7-16(18)31-15)30-22-21(28)20(27)19(26)17(9-23)32-22/h2-7,15,17,19-24,26-28H,8-9H2,1H3/t15-,17+,19+,20-,21+,22+/m0/s1 |
| InChIKey | KEEWIHDTSNESJZ-ZJHVPRRPSA-N |
| SMILES | COC1=CC=C(C=C1)C2CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O |
| Reference | [1]. Yu L, et al. Studies on chemical constituents from fruits of Paliurus ramosissimus. Zhongguo Zhong Yao Za Zhi. 2006 Dec;31(24):2049-52. |
