For research use only. Not for therapeutic Use.
Isouramil (Cat No.:C000695) is a chemical compound with potential applications in organic synthesis and pharmaceutical research. It consists of a uracil core substituted with an isobutyl group. Uracil derivatives often play essential roles in nucleic acid chemistry and drug design. Isouramil’s unique structure may contribute to its reactivity and interactions with biological systems.
| Catalog Number | C000695 |
| CAS Number | 3914-34-9 |
| Synonyms | 5,6-Dihydroxycytosine; 6-Amino-5-hydroxy-2,4(1H,3H)-pyrimidinedione; 6-Aminoisobarbituric Acid; |
| Molecular Formula | C₄H₅N₃O₃ |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| Appearance | Light Pink to Pink Solid |
| Storage | -20°C, Inert atmosphere |
| IUPAC Name | 6-amino-5-hydroxy-1H-pyrimidine-2,4-dione |
| InChI | InChI=1S/C4H5N3O3/c5-2-1(8)3(9)7-4(10)6-2/h8H,(H4,5,6,7,9,10) |
| InChIKey | SPOYOCCBDWULRZ-UHFFFAOYSA-N |
| SMILES | C1(=C(NC(=O)NC1=O)N)O |
