For research use only. Not for therapeutic Use.
Isovalerophenone (Cat.No:I014414) is an organic compound belonging to the ketone family. It is also known as 3-methyl-2-butanone or isobutyl methyl ketone. Isovalerophenone is a colorless liquid with a fruity odor. It is primarily used as a flavoring agent in the food industry and as a solvent in various industrial applications.
| Catalog Number | I014414 |
| CAS Number | 582-62-7 |
| Synonyms | IsovaleropheNA;1-ButaNA, 3-methyl-1-phenyl- |
| Molecular Formula | C11H14O |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| InChI | InChI=1S/C11H14O/c1-9(2)8-11(12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | HEOVGVNITGAUKL-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C1=CC=CC=C1)=O |
