For research use only, not for therapeutic use.
Isoxanthohumol(CAT: R003237) is a prenylated flavonoid compound found in hops (Humulus lupulus). Its action target involves various biological activities due to its complex chemical structure. The mode of action includes potential antioxidant, anti-inflammatory, and anticancer effects. Pharmacologically, Isoxanthohumol has shown promise in various medicinal applications, including its potential as an antioxidant agent to combat oxidative stress and its ability to reduce inflammation. Additionally, it has been investigated for its potential in cancer prevention and treatment due to its ability to inhibit the growth and proliferation of certain cancer cells.
| Catalog Number | R003237 |
| CAS Number | 521-48-2 |
| Molecular Formula | C21H22O5 |
| Purity | ≥95% |
| IUPAC Name | 7-hydroxy-2-(4-hydroxyphenyl)-5-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C21H22O5/c1-12(2)4-9-15-16(23)10-19(25-3)20-17(24)11-18(26-21(15)20)13-5-7-14(22)8-6-13/h4-8,10,18,22-23H,9,11H2,1-3H3 |
| InChIKey | YKGCBLWILMDSAV-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=C(C2=C1OC(CC2=O)C3=CC=C(C=C3)O)OC)O)C |
