For research use only. Not for therapeutic Use.
ISRIB (Cat No.:I011731) is a small molecule that targets the integrated stress response (ISR) pathway, which plays a key role in cellular stress adaptation. By inhibiting this pathway, ISRIB enhances protein synthesis and cellular function, particularly in response to stress conditions like neurodegeneration, injury, or aging. ISRIB has shown promise in preclinical studies for its potential to alleviate cognitive impairments, improve memory, and support neuronal survival in models of Alzheimer’s disease, traumatic brain injury, and other neurological conditions. It holds potential as a therapeutic agent for restoring cellular homeostasis and improving brain health.
CAS Number | 548470-11-7 |
Synonyms | 2-(4-chlorophenoxy)-N-[4-[[2-(4-chlorophenoxy)acetyl]amino]cyclohexyl]acetamide |
Molecular Formula | C22H24Cl2N2O4 |
Purity | ≥95% |
IUPAC Name | 2-(4-chlorophenoxy)-N-[4-[[2-(4-chlorophenoxy)acetyl]amino]cyclohexyl]acetamide |
InChI | InChI=1S/C22H24Cl2N2O4/c23-15-1-9-19(10-2-15)29-13-21(27)25-17-5-7-18(8-6-17)26-22(28)14-30-20-11-3-16(24)4-12-20/h1-4,9-12,17-18H,5-8,13-14H2,(H,25,27)(H,26,28) |
InChIKey | HJGMCDHQPXTGAV-UHFFFAOYSA-N |
SMILES | C1CC(CCC1NC(=O)COC2=CC=C(C=C2)Cl)NC(=O)COC3=CC=C(C=C3)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |