For research use only. Not for therapeutic Use.
IST5-002（Cat No.:M054577）is a small molecule inhibitor that targets the Hsp70 protein, a key player in cellular stress response and protein homeostasis. By inhibiting Hsp70, IST5-002 disrupts the function of the chaperone system, leading to the degradation of misfolded or damaged proteins. This action makes IST5-002 a potential therapeutic agent for diseases associated with protein aggregation, such as neurodegenerative disorders (e.g., Alzheimer’s or Parkinson’s disease) and cancer. Its selective targeting of Hsp70 makes it a promising candidate for research and drug development in treating diseases linked to protein misfolding and accumulation.
| CAS Number | 13484-66-7 |
| Synonyms | [(2R,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| Molecular Formula | C17H20N5O7P |
| Purity | ≥95% |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChI | InChI=1S/C17H20N5O7P/c23-13-11(7-28-30(25,26)27)29-17(14(13)24)22-9-21-12-15(19-8-20-16(12)22)18-6-10-4-2-1-3-5-10/h1-5,8-9,11,13-14,17,23-24H,6-7H2,(H,18,19,20)(H2,25,26,27)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | DWVANBHPEPSMOV-LSCFUAHRSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)COP(=O)(O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
