For research use only. Not for therapeutic Use.
IT1t dihydrochloride（Cat No.:I010988） is a highly potent antagonist of the chemokine receptor CXCR4. It effectively inhibits the interaction between CXCL12 (also known as SDF-1) and CXCR4 with an IC50 of 2.1 nM. By blocking the CXCL12/CXCR4 signaling axis, IT1t dihydrochloride can interfere with cellular processes mediated by CXCR4, such as cell migration and metastasis. Its strong inhibitory activity against CXCR4 makes it a promising compound for potential therapeutic applications, particularly in the context of cancer and inflammatory diseases.
| Catalog Number | I010988 |
| CAS Number | 1092776-63-0 |
| Synonyms | N,N/’-Dicyclohexylcarbamimidothioic acid (5,6-dihydro-6,6-dimethylimidazo[2,1-b]thiazol-3-yl)methyl ester dihydrochloride |
| Molecular Formula | C21H34N4S2.2HCl |
| Purity | ≥95% |
| Target | Chemokine Receptors |
| Solubility | Soluble to 10 mM in DMSO and to 100 mM in water |
| Storage | -20°C |
| IUPAC Name | (6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-3-yl)methyl N,N'-dicyclohexylcarbamimidothioate;dihydrochloride |
| InChI | InChI=1S/C21H34N4S2.2ClH/c1-21(2)15-25-18(14-27-20(25)24-21)13-26-19(22-16-9-5-3-6-10-16)23-17-11-7-4-8-12-17;;/h14,16-17H,3-13,15H2,1-2H3,(H,22,23);2*1H |
| InChIKey | HFXJOXOIINQOEB-UHFFFAOYSA-N |
| SMILES | CC1(CN2C(=CSC2=N1)CSC(=NC3CCCCC3)NC4CCCCC4)C.Cl.Cl |
